C16H17N3 — CID 154634129
3,3-bis(4-aminophenyl)butanenitrile (PubChem CID 154634129) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3,3-bis(4-aminophenyl)butanenitrile.
| Compound Name | 3,3-bis(4-aminophenyl)butanenitrile |
|---|---|
| PubChem CID | 154634129 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3,3-bis(4-aminophenyl)butanenitrile |
| SMILES | CC(CC#N)(c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H17N3/c1-16(10-11-17,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-9H,10,18-19H2,1H3 |
| InChIKey | QJIAUWSNGGTYGL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|