C16H17F3N2 — CID 154634122
4-[2-(4-aminophenyl)-4,4,4-trifluorobutan-2-yl]aniline (PubChem CID 154634122) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)-4,4,4-trifluorobutan-2-yl]aniline.
| Compound Name | 4-[2-(4-aminophenyl)-4,4,4-trifluorobutan-2-yl]aniline |
|---|---|
| PubChem CID | 154634122 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-[2-(4-aminophenyl)-4,4,4-trifluorobutan-2-yl]aniline |
| SMILES | CC(CC(F)(F)F)(c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H17F3N2/c1-15(10-16(17,18)19,11-2-6-13(20)7-3-11)12-4-8-14(21)9-5-12/h2-9H,10,20-21H2,1H3 |
| InChIKey | CHOMVWPPNJDCIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|