About (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid
(2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid (PubChem CID 154634481) has the molecular formula C6H10NO5PS
and a molecular weight of 239.19 g/mol. Its IUPAC name is (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid |
| PubChem CID | 154634481 |
| Molecular Formula | C6H10NO5PS |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)CCC#P=O)C(=O)O |
| InChI | InChI=1S/C6H10NO5PS/c1-5(6(8)9)7-14(11,12)4-2-3-13-10/h5,7H,2,4H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | KQWPLTNPKHEDDQ-RXMQYKEDSA-N |
| XLogP | 0.02 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid?
The IUPAC name of (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid (CID 154634481) is (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid.
What is the SMILES notation for (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid?
The canonical SMILES for (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid is C[C@@H](NS(=O)(=O)CCC#P=O)C(=O)O.
What is the InChIKey of (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid?
The InChIKey is KQWPLTNPKHEDDQ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10NO5PS/c1-5(6(8)9)7-14(11,12)4-2-3-13-10/h5,7H,2,4H2,1H3,(H,8,9)/t5-/m1/s1.
What are the key properties of (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid?
(2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid has a molecular weight of 239.19 g/mol, XLogP of 0.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid is sourced from PubChem (CID 154634481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).