C6H10NO5PS — CID 154634481
(2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid (PubChem CID 154634481) has the molecular formula C6H10NO5PS and a molecular weight of 239.19 g/mol. Its IUPAC name is (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 154634481 |
| Molecular Formula | C6H10NO5PS |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | (2R)-2-[3-(oxo-λ5-phosphanylidyne)propylsulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)CCC#P=O)C(=O)O |
| InChI | InChI=1S/C6H10NO5PS/c1-5(6(8)9)7-14(11,12)4-2-3-13-10/h5,7H,2,4H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | KQWPLTNPKHEDDQ-RXMQYKEDSA-N |
| XLogP | 0.02 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|