C7H15NO4S — CID 78995773
(2R)-2-(2-methylpropylsulfonylamino)propanoic acid (PubChem CID 78995773) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is (2R)-2-(2-methylpropylsulfonylamino)propanoic acid.
| Compound Name | (2R)-2-(2-methylpropylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 78995773 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2R)-2-(2-methylpropylsulfonylamino)propanoic acid |
| SMILES | CC(C)CS(=O)(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C7H15NO4S/c1-5(2)4-13(11,12)8-6(3)7(9)10/h5-6,8H,4H2,1-3H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | QORICVANAZWNHF-ZCFIWIBFSA-N |
| XLogP | 0.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |