C8H11N5O — CID 154636527
2-amino-1-ethenyl-2,3,4a,5-tetrahydropteridin-4-one (PubChem CID 154636527) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-amino-1-ethenyl-2,3,4a,5-tetrahydropteridin-4-one.
| Compound Name | 2-amino-1-ethenyl-2,3,4a,5-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 154636527 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-amino-1-ethenyl-2,3,4a,5-tetrahydropteridin-4-one |
| SMILES | C=CN1C2=NC=CNC2C(=O)NC1N |
| InChI | InChI=1S/C8H11N5O/c1-2-13-6-5(10-3-4-11-6)7(14)12-8(13)9/h2-5,8,10H,1,9H2,(H,12,14) |
| InChIKey | LXMCZTRDPGUBLA-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |