C34H37N3O5 — CID 154636704
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[4-[(4-formylphenyl)methoxy]benzoyl]-4-phenylpiperidin-4-yl]carbamate (PubChem CID 154636704) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[4-[(4-formylphenyl)methoxy]benzoyl]-4-phenylpiperidin-4-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[4-[(4-formylphenyl)methoxy]benzoyl]-4-phenylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154636704 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[4-[(4-formylphenyl)methoxy]benzoyl]-4-phenylpiperidin-4-yl]carbamate |
| SMILES | O=Cc1ccc(COc2ccc(C(=O)N3CCC(NC(=O)O[C@H]4CN5CCC4CC5)(c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H37N3O5/c38-23-25-6-8-26(9-7-25)24-41-30-12-10-28(11-13-30)32(39)37-20-16-34(17-21-37,29-4-2-1-3-5-29)35-33(40)42-31-22-36-18-14-27(31)15-19-36/h1-13,23,27,31H,14-22,24H2,(H,35,40)/t31-/m0/s1 |
| InChIKey | SURFIOXWWZNOIP-HKBQPEDESA-N |
| XLogP | 5.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|