C30H37N3O5 — CID 154636753
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[3-[4-(4-oxobutoxy)phenyl]propanoyl]-3-phenylazetidin-3-yl]carbamate (PubChem CID 154636753) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[3-[4-(4-oxobutoxy)phenyl]propanoyl]-3-phenylazetidin-3-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[3-[4-(4-oxobutoxy)phenyl]propanoyl]-3-phenylazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 154636753 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[1-[3-[4-(4-oxobutoxy)phenyl]propanoyl]-3-phenylazetidin-3-yl]carbamate |
| SMILES | O=CCCCOc1ccc(CCC(=O)N2CC(NC(=O)O[C@H]3CN4CCC3CC4)(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H37N3O5/c34-18-4-5-19-37-26-11-8-23(9-12-26)10-13-28(35)33-21-30(22-33,25-6-2-1-3-7-25)31-29(36)38-27-20-32-16-14-24(27)15-17-32/h1-3,6-9,11-12,18,24,27H,4-5,10,13-17,19-22H2,(H,31,36)/t27-/m0/s1 |
| InChIKey | GSAQGCAFALGOCB-MHZLTWQESA-N |
| XLogP | 3.54 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|