C10H15FN4O — CID 154637394
1-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-N-ethylpyrazole-3-carboxamide (PubChem CID 154637394) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-N-ethylpyrazole-3-carboxamide.
| Compound Name | 1-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-N-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154637394 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-N-ethylpyrazole-3-carboxamide |
| SMILES | CCNC(=O)c1ccn(C/C(=C/F)CN)n1 |
| InChI | InChI=1S/C10H15FN4O/c1-2-13-10(16)9-3-4-15(14-9)7-8(5-11)6-12/h3-5H,2,6-7,12H2,1H3,(H,13,16)/b8-5+ |
| InChIKey | GNSWMNZXWIMDSI-VMPITWQZSA-N |
| XLogP | 0.44 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |