C19H17ClFN5O4S — CID 154638110
5-chloro-2-N-(4-fluoro-3-nitrophenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 154638110) has the molecular formula C19H17ClFN5O4S and a molecular weight of 465.89 g/mol. Its IUPAC name is 5-chloro-2-N-(4-fluoro-3-nitrophenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(4-fluoro-3-nitrophenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154638110 |
| Molecular Formula | C19H17ClFN5O4S |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 5-chloro-2-N-(4-fluoro-3-nitrophenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(F)c([N+](=O)[O-])c2)ncc1Cl |
| InChI | InChI=1S/C19H17ClFN5O4S/c1-11(2)31(29,30)17-6-4-3-5-15(17)24-18-13(20)10-22-19(25-18)23-12-7-8-14(21)16(9-12)26(27)28/h3-11H,1-2H3,(H2,22,23,24,25) |
| InChIKey | QUVYFRBKWKGQQA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|