C22H31N — CID 154638784
N-ethyl-2,5-dimethyl-2,5-diphenylhexan-3-amine (PubChem CID 154638784) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is N-ethyl-2,5-dimethyl-2,5-diphenylhexan-3-amine.
| Compound Name | N-ethyl-2,5-dimethyl-2,5-diphenylhexan-3-amine |
|---|---|
| PubChem CID | 154638784 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N-ethyl-2,5-dimethyl-2,5-diphenylhexan-3-amine |
| SMILES | CCNC(CC(C)(C)c1ccccc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H31N/c1-6-23-20(22(4,5)19-15-11-8-12-16-19)17-21(2,3)18-13-9-7-10-14-18/h7-16,20,23H,6,17H2,1-5H3 |
| InChIKey | ZWRHXDJMHJMJNI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |