C17H29NO — CID 65107916
2-methyl-1-[(4-methyl-4-phenylpentan-2-yl)amino]butan-2-ol (PubChem CID 65107916) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-4-phenylpentan-2-yl)amino]butan-2-ol.
| Compound Name | 2-methyl-1-[(4-methyl-4-phenylpentan-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 65107916 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-methyl-1-[(4-methyl-4-phenylpentan-2-yl)amino]butan-2-ol |
| SMILES | CCC(C)(O)CNC(C)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-6-17(5,19)13-18-14(2)12-16(3,4)15-10-8-7-9-11-15/h7-11,14,18-19H,6,12-13H2,1-5H3 |
| InChIKey | GWHSDYWHLPUCKE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |