About methyl 3-cyano-1,2,4-triazole-3-carboxylate
methyl 3-cyano-1,2,4-triazole-3-carboxylate (PubChem CID 154639046) has the molecular formula C5H4N4O2
and a molecular weight of 152.11 g/mol. Its IUPAC name is methyl 3-cyano-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 3-cyano-1,2,4-triazole-3-carboxylate |
| PubChem CID | 154639046 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | methyl 3-cyano-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)C1(C#N)N=CN=N1 |
| InChI | InChI=1S/C5H4N4O2/c1-11-4(10)5(2-6)7-3-8-9-5/h3H,1H3 |
| InChIKey | RPMSDLSGADVUTH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 87.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-cyano-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyano-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 3-cyano-1,2,4-triazole-3-carboxylate (CID 154639046) is methyl 3-cyano-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 3-cyano-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 3-cyano-1,2,4-triazole-3-carboxylate is COC(=O)C1(C#N)N=CN=N1.
What is the InChIKey of methyl 3-cyano-1,2,4-triazole-3-carboxylate?
The InChIKey is RPMSDLSGADVUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2/c1-11-4(10)5(2-6)7-3-8-9-5/h3H,1H3.
What are the key properties of methyl 3-cyano-1,2,4-triazole-3-carboxylate?
methyl 3-cyano-1,2,4-triazole-3-carboxylate has a molecular weight of 152.11 g/mol, XLogP of -0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 154639046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).