C15H10ClFN2O4 — CID 91694225
dimethyl 3-(4-chloro-2-fluorophenyl)-2,2-dicyanocyclopropane-1,1-dicarboxylate (PubChem CID 91694225) has the molecular formula C15H10ClFN2O4 and a molecular weight of 336.71 g/mol. Its IUPAC name is dimethyl 3-(4-chloro-2-fluorophenyl)-2,2-dicyanocyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(4-chloro-2-fluorophenyl)-2,2-dicyanocyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 91694225 |
| Molecular Formula | C15H10ClFN2O4 |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | dimethyl 3-(4-chloro-2-fluorophenyl)-2,2-dicyanocyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccc(Cl)cc2F)C1(C#N)C#N |
| InChI | InChI=1S/C15H10ClFN2O4/c1-22-12(20)15(13(21)23-2)11(14(15,6-18)7-19)9-4-3-8(16)5-10(9)17/h3-5,11H,1-2H3 |
| InChIKey | QIFDEUOLINXORE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|