C15H11FN2O4 — CID 91694182
dimethyl 2,2-dicyano-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate (PubChem CID 91694182) has the molecular formula C15H11FN2O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is dimethyl 2,2-dicyano-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2,2-dicyano-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 91694182 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | dimethyl 2,2-dicyano-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2cccc(F)c2)C1(C#N)C#N |
| InChI | InChI=1S/C15H11FN2O4/c1-21-12(19)15(13(20)22-2)11(14(15,7-17)8-18)9-4-3-5-10(16)6-9/h3-6,11H,1-2H3 |
| InChIKey | MVLQGSJBGZFFLG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|