C27H16F3N5 — CID 134811916
2,4,6-tris(3-fluorophenyl)piperidine-3,3,5,5-tetracarbonitrile (PubChem CID 134811916) has the molecular formula C27H16F3N5 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2,4,6-tris(3-fluorophenyl)piperidine-3,3,5,5-tetracarbonitrile.
| Compound Name | 2,4,6-tris(3-fluorophenyl)piperidine-3,3,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 134811916 |
| Molecular Formula | C27H16F3N5 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2,4,6-tris(3-fluorophenyl)piperidine-3,3,5,5-tetracarbonitrile |
| SMILES | N#CC1(C#N)C(c2cccc(F)c2)NC(c2cccc(F)c2)C(C#N)(C#N)C1c1cccc(F)c1 |
| InChI | InChI=1S/C27H16F3N5/c28-20-7-1-4-17(10-20)23-26(13-31,14-32)24(18-5-2-8-21(29)11-18)35-25(27(23,15-33)16-34)19-6-3-9-22(30)12-19/h1-12,23-25,35H |
| InChIKey | PMMLOPMNXAIRFL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |