C26H22F2N2O5 — CID 50992601
dimethyl (1S,2R,3R,4R,5R)-5-acetyl-1,3-dicyano-2,4-bis(3-fluorophenyl)cyclohexane-1,3-dicarboxylate (PubChem CID 50992601) has the molecular formula C26H22F2N2O5 and a molecular weight of 480.47 g/mol. Its IUPAC name is dimethyl (1S,2R,3R,4R,5R)-5-acetyl-1,3-dicyano-2,4-bis(3-fluorophenyl)cyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3R,4R,5R)-5-acetyl-1,3-dicyano-2,4-bis(3-fluorophenyl)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 50992601 |
| Molecular Formula | C26H22F2N2O5 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | dimethyl (1S,2R,3R,4R,5R)-5-acetyl-1,3-dicyano-2,4-bis(3-fluorophenyl)cyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@]1(C#N)[C@@H](c2cccc(F)c2)[C@H](C(C)=O)C[C@](C#N)(C(=O)OC)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C26H22F2N2O5/c1-15(31)20-12-25(13-29,23(32)34-2)22(17-7-5-9-19(28)11-17)26(14-30,24(33)35-3)21(20)16-6-4-8-18(27)10-16/h4-11,20-22H,12H2,1-3H3/t20-,21-,22+,25+,26+/m0/s1 |
| InChIKey | HQFWSZNQMIYAJB-WQVMVKNYSA-N |
| XLogP | 3.81 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |