C17H13ClO3 — CID 21480715
methyl 4-chloro-12-hydroxytetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate (PubChem CID 21480715) has the molecular formula C17H13ClO3 and a molecular weight of 300.74 g/mol. Its IUPAC name is methyl 4-chloro-12-hydroxytetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate.
| Compound Name | methyl 4-chloro-12-hydroxytetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 21480715 |
| Molecular Formula | C17H13ClO3 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 4-chloro-12-hydroxytetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate |
| SMILES | COC(=O)C12CC(c3ccc(O)cc31)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C17H13ClO3/c1-21-16(20)17-8-13(11-4-2-9(18)6-14(11)17)12-5-3-10(19)7-15(12)17/h2-7,13,19H,8H2,1H3 |
| InChIKey | ATKPXSDQDOJHIE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |