C34H40N8O2 — CID 154640432
3-[2-[2-[[1-(3-methoxypropyl)-3-methylpyrazol-4-yl]amino]pyrimidin-5-yl]ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 154640432) has the molecular formula C34H40N8O2 and a molecular weight of 592.75 g/mol. Its IUPAC name is 3-[2-[2-[[1-(3-methoxypropyl)-3-methylpyrazol-4-yl]amino]pyrimidin-5-yl]ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 3-[2-[2-[[1-(3-methoxypropyl)-3-methylpyrazol-4-yl]amino]pyrimidin-5-yl]ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 154640432 |
| Molecular Formula | C34H40N8O2 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 3-[2-[2-[[1-(3-methoxypropyl)-3-methylpyrazol-4-yl]amino]pyrimidin-5-yl]ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | COCCCn1cc(Nc2ncc(C#Cc3cc(C(=O)Nc4ccc(CN5CCN(C)CC5)cc4)ccc3C)cn2)c(C)n1 |
| InChI | InChI=1S/C34H40N8O2/c1-25-6-10-30(33(43)37-31-12-8-27(9-13-31)23-41-17-15-40(3)16-18-41)20-29(25)11-7-28-21-35-34(36-22-28)38-32-24-42(39-26(32)2)14-5-19-44-4/h6,8-10,12-13,20-22,24H,5,14-19,23H2,1-4H3,(H,37,43)(H,35,36,38) |
| InChIKey | GJEFDKOUAVEOPB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|