C30H43N3O7 — CID 154643253
3-formyl-N-[3-(2-hydroxy-2-methylpent-4-enoxy)-2,2-dimethylpropyl]-5-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]benzamide (PubChem CID 154643253) has the molecular formula C30H43N3O7 and a molecular weight of 557.69 g/mol. Its IUPAC name is 3-formyl-N-[3-(2-hydroxy-2-methylpent-4-enoxy)-2,2-dimethylpropyl]-5-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]benzamide.
| Compound Name | 3-formyl-N-[3-(2-hydroxy-2-methylpent-4-enoxy)-2,2-dimethylpropyl]-5-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]benzamide |
|---|---|
| PubChem CID | 154643253 |
| Molecular Formula | C30H43N3O7 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | 3-formyl-N-[3-(2-hydroxy-2-methylpent-4-enoxy)-2,2-dimethylpropyl]-5-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]benzamide |
| SMILES | C=CCC(C)(O)COCC(C)(C)CNC(=O)c1cc(C=O)cc(NC(=O)CCCCCN(C)C(=O)/C=C\C=O)c1 |
| InChI | InChI=1S/C30H43N3O7/c1-6-13-30(4,39)22-40-21-29(2,3)20-31-28(38)24-16-23(19-35)17-25(18-24)32-26(36)11-8-7-9-14-33(5)27(37)12-10-15-34/h6,10,12,15-19,39H,1,7-9,11,13-14,20-22H2,2-5H3,(H,31,38)(H,32,36)/b12-10- |
| InChIKey | PLLAEMTUFJNSNO-BENRWUELSA-N |
| XLogP | 3.31 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|