C23H39N4O4P — CID 154643324
3-[[3-[[amino(methyl)phosphanyl]methoxy]-2,2-dimethylpropyl]-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]amino]propanoic acid (PubChem CID 154643324) has the molecular formula C23H39N4O4P and a molecular weight of 466.56 g/mol. Its IUPAC name is 3-[[3-[[amino(methyl)phosphanyl]methoxy]-2,2-dimethylpropyl]-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[[amino(methyl)phosphanyl]methoxy]-2,2-dimethylpropyl]-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 154643324 |
| Molecular Formula | C23H39N4O4P |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 3-[[3-[[amino(methyl)phosphanyl]methoxy]-2,2-dimethylpropyl]-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]amino]propanoic acid |
| SMILES | CP(N)COCC(C)(C)CN(CCC(=O)O)C(=O)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C23H39N4O4P/c1-23(2,16-31-17-32(3)24)15-27(14-12-21(29)30)20(28)9-5-4-8-19-11-10-18-7-6-13-25-22(18)26-19/h10-11H,4-9,12-17,24H2,1-3H3,(H,25,26)(H,29,30) |
| InChIKey | DMXOSHUKNVQHIH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|