C13H22ClN — CID 154644137
(2E,4E)-4-chloro-2,3-dimethyl-N-[(E)-prop-1-enyl]hexa-2,4-dien-1-imine;ethane (PubChem CID 154644137) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is (2E,4E)-4-chloro-2,3-dimethyl-N-[(E)-prop-1-enyl]hexa-2,4-dien-1-imine;ethane.
| Compound Name | (2E,4E)-4-chloro-2,3-dimethyl-N-[(E)-prop-1-enyl]hexa-2,4-dien-1-imine;ethane |
|---|---|
| PubChem CID | 154644137 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2E,4E)-4-chloro-2,3-dimethyl-N-[(E)-prop-1-enyl]hexa-2,4-dien-1-imine;ethane |
| SMILES | C/C=C/N=C/C(C)=C(C)/C(Cl)=C\C.CC |
| InChI | InChI=1S/C11H16ClN.C2H6/c1-5-7-13-8-9(3)10(4)11(12)6-2;1-2/h5-8H,1-4H3;1-2H3/b7-5+,10-9+,11-6+,13-8+; |
| InChIKey | KJROYYVYFHTDMX-YRZVHPHESA-N |
| XLogP | 5.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|