About 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol
1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol (PubChem CID 154645715) has the molecular formula C20H20F3NO4
and a molecular weight of 395.38 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol |
| PubChem CID | 154645715 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol |
| SMILES | CCC(O)(CCc1ccc(Oc2nc3ccccc3o2)c(OC)c1)C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO4/c1-3-19(25,20(21,22)23)11-10-13-8-9-16(17(12-13)26-2)28-18-24-14-6-4-5-7-15(14)27-18/h4-9,12,25H,3,10-11H2,1-2H3 |
| InChIKey | PQRDZIUGKFGRCU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol?
The IUPAC name of 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol (CID 154645715) is 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol.
What is the SMILES notation for 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol?
The canonical SMILES for 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol is CCC(O)(CCc1ccc(Oc2nc3ccccc3o2)c(OC)c1)C(F)(F)F.
What is the InChIKey of 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol?
The InChIKey is PQRDZIUGKFGRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO4/c1-3-19(25,20(21,22)23)11-10-13-8-9-16(17(12-13)26-2)28-18-24-14-6-4-5-7-15(14)27-18/h4-9,12,25H,3,10-11H2,1-2H3.
What are the key properties of 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol?
1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol has a molecular weight of 395.38 g/mol, XLogP of 5.26, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzoxazol-2-yloxy)-3-methoxyphenyl]-3-(trifluoromethyl)pentan-3-ol is sourced from PubChem (CID 154645715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).