C24H27Cl3N2O8 — CID 154648218
(4-amino-3-propanoylphenyl) ethyl carbonate;(4-amino-3-propanoylphenyl) 2,2,2-trichloroethyl carbonate (PubChem CID 154648218) has the molecular formula C24H27Cl3N2O8 and a molecular weight of 577.85 g/mol. Its IUPAC name is (4-amino-3-propanoylphenyl) ethyl carbonate;(4-amino-3-propanoylphenyl) 2,2,2-trichloroethyl carbonate.
| Compound Name | (4-amino-3-propanoylphenyl) ethyl carbonate;(4-amino-3-propanoylphenyl) 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 154648218 |
| Molecular Formula | C24H27Cl3N2O8 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | (4-amino-3-propanoylphenyl) ethyl carbonate;(4-amino-3-propanoylphenyl) 2,2,2-trichloroethyl carbonate |
| SMILES | CCC(=O)c1cc(OC(=O)OCC(Cl)(Cl)Cl)ccc1N.CCOC(=O)Oc1ccc(N)c(C(=O)CC)c1 |
| InChI | InChI=1S/C12H12Cl3NO4.C12H15NO4/c1-2-10(17)8-5-7(3-4-9(8)16)20-11(18)19-6-12(13,14)15;1-3-11(14)9-7-8(5-6-10(9)13)17-12(15)16-4-2/h3-5H,2,6,16H2,1H3;5-7H,3-4,13H2,1-2H3 |
| InChIKey | HONRMRMPYPNSFE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|