C24H23Cl3O8 — CID 155005576
[5-oxo-5-[3-(2,2,2-trichloroethoxycarbonyloxy)phenyl]pentyl] (3-propanoylphenyl) carbonate (PubChem CID 155005576) has the molecular formula C24H23Cl3O8 and a molecular weight of 545.80 g/mol. Its IUPAC name is [5-oxo-5-[3-(2,2,2-trichloroethoxycarbonyloxy)phenyl]pentyl] (3-propanoylphenyl) carbonate.
| Compound Name | [5-oxo-5-[3-(2,2,2-trichloroethoxycarbonyloxy)phenyl]pentyl] (3-propanoylphenyl) carbonate |
|---|---|
| PubChem CID | 155005576 |
| Molecular Formula | C24H23Cl3O8 |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | [5-oxo-5-[3-(2,2,2-trichloroethoxycarbonyloxy)phenyl]pentyl] (3-propanoylphenyl) carbonate |
| SMILES | CCC(=O)c1cccc(OC(=O)OCCCCC(=O)c2cccc(OC(=O)OCC(Cl)(Cl)Cl)c2)c1 |
| InChI | InChI=1S/C24H23Cl3O8/c1-2-20(28)16-7-5-9-18(13-16)34-22(30)32-12-4-3-11-21(29)17-8-6-10-19(14-17)35-23(31)33-15-24(25,26)27/h5-10,13-14H,2-4,11-12,15H2,1H3 |
| InChIKey | URLJNKQSVWVAPW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|