About 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide
2-ethylpentan-1-ol;N-(1-phenylethyl)formamide (PubChem CID 154648381) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide.
Molecular Properties
| Compound Name | 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide |
| PubChem CID | 154648381 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide |
| SMILES | CC(NC=O)c1ccccc1.CCCC(CC)CO |
| InChI | InChI=1S/C9H11NO.C7H16O/c1-8(10-7-11)9-5-3-2-4-6-9;1-3-5-7(4-2)6-8/h2-8H,1H3,(H,10,11);7-8H,3-6H2,1-2H3 |
| InChIKey | QWGUCKDEACVFIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide?
The IUPAC name of 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide (CID 154648381) is 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide.
What is the SMILES notation for 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide?
The canonical SMILES for 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide is CC(NC=O)c1ccccc1.CCCC(CC)CO.
What is the InChIKey of 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide?
The InChIKey is QWGUCKDEACVFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C7H16O/c1-8(10-7-11)9-5-3-2-4-6-9;1-3-5-7(4-2)6-8/h2-8H,1H3,(H,10,11);7-8H,3-6H2,1-2H3.
What are the key properties of 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide?
2-ethylpentan-1-ol;N-(1-phenylethyl)formamide has a molecular weight of 265.40 g/mol, XLogP of 3.30, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentan-1-ol;N-(1-phenylethyl)formamide is sourced from PubChem (CID 154648381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).