C16H12N2Ni — CID 154649169
[(2E,4E)-5-(5-cyano-1H-indol-3-yl)-3-ethenylpenta-2,4-dienylidene]nickel (PubChem CID 154649169) has the molecular formula C16H12N2Ni and a molecular weight of 290.98 g/mol. Its IUPAC name is [(2E,4E)-5-(5-cyano-1H-indol-3-yl)-3-ethenylpenta-2,4-dienylidene]nickel.
| Compound Name | [(2E,4E)-5-(5-cyano-1H-indol-3-yl)-3-ethenylpenta-2,4-dienylidene]nickel |
|---|---|
| PubChem CID | 154649169 |
| Molecular Formula | C16H12N2Ni |
| Molecular Weight | 290.98 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | [(2E,4E)-5-(5-cyano-1H-indol-3-yl)-3-ethenylpenta-2,4-dienylidene]nickel |
| SMILES | C=CC(/C=C/c1c[nH]c2ccc(C#N)cc12)=C\C=[Ni] |
| InChI | InChI=1S/C16H12N2.Ni/c1-3-12(4-2)5-7-14-11-18-16-8-6-13(10-17)9-15(14)16;/h1,3-9,11,18H,2H2;/b7-5+,12-3+; |
| InChIKey | WTTOJBHYDDYJGD-CDCXDIKFSA-N |
| XLogP | 3.51 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|