About 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine
4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine (PubChem CID 154649469) has the molecular formula C14H11N7
and a molecular weight of 277.29 g/mol. Its IUPAC name is 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine |
| PubChem CID | 154649469 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine |
| SMILES | Nc1cc(-c2ccn[nH]2)c2ncc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C14H11N7/c15-13-6-9(11-2-4-18-21-11)14-12(19-13)5-8(7-16-14)10-1-3-17-20-10/h1-7H,(H2,15,19)(H,17,20)(H,18,21) |
| InChIKey | URHVIRKAOPGAQK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine?
The IUPAC name of 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine (CID 154649469) is 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine.
What is the SMILES notation for 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine?
The canonical SMILES for 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine is Nc1cc(-c2ccn[nH]2)c2ncc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine?
The InChIKey is URHVIRKAOPGAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N7/c15-13-6-9(11-2-4-18-21-11)14-12(19-13)5-8(7-16-14)10-1-3-17-20-10/h1-7H,(H2,15,19)(H,17,20)(H,18,21).
What are the key properties of 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine?
4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine has a molecular weight of 277.29 g/mol, XLogP of 1.99, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine is sourced from PubChem (CID 154649469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).