C14H11N7 — CID 154649469
4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine (PubChem CID 154649469) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 154649469 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4,7-bis(1H-pyrazol-5-yl)-1,5-naphthyridin-2-amine |
| SMILES | Nc1cc(-c2ccn[nH]2)c2ncc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C14H11N7/c15-13-6-9(11-2-4-18-21-11)14-12(19-13)5-8(7-16-14)10-1-3-17-20-10/h1-7H,(H2,15,19)(H,17,20)(H,18,21) |
| InChIKey | URHVIRKAOPGAQK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |