About 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine
7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine (PubChem CID 154649481) has the molecular formula C11H10N6
and a molecular weight of 226.24 g/mol. Its IUPAC name is 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine.
Molecular Properties
| Compound Name | 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine |
| PubChem CID | 154649481 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine |
| SMILES | Nc1cc(N)c2ncc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C11H10N6/c12-7-4-10(13)16-9-3-6(5-14-11(7)9)8-1-2-15-17-8/h1-5H,(H,15,17)(H4,12,13,16) |
| InChIKey | HFQCYRCOKIOSMH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine?
The IUPAC name of 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine (CID 154649481) is 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine.
What is the SMILES notation for 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine?
The canonical SMILES for 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine is Nc1cc(N)c2ncc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine?
The InChIKey is HFQCYRCOKIOSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6/c12-7-4-10(13)16-9-3-6(5-14-11(7)9)8-1-2-15-17-8/h1-5H,(H,15,17)(H4,12,13,16).
What are the key properties of 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine?
7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine has a molecular weight of 226.24 g/mol, XLogP of 1.18, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine is sourced from PubChem (CID 154649481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).