C11H10N6 — CID 154649481
7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine (PubChem CID 154649481) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine.
| Compound Name | 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine |
|---|---|
| PubChem CID | 154649481 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 7-(1H-pyrazol-5-yl)-1,5-naphthyridine-2,4-diamine |
| SMILES | Nc1cc(N)c2ncc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C11H10N6/c12-7-4-10(13)16-9-3-6(5-14-11(7)9)8-1-2-15-17-8/h1-5H,(H,15,17)(H4,12,13,16) |
| InChIKey | HFQCYRCOKIOSMH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |