C16H32N2O3S — CID 154652687
tert-butyl 4-(tert-butylsulfinylamino)-4-methylazepane-1-carboxylate (PubChem CID 154652687) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is tert-butyl 4-(tert-butylsulfinylamino)-4-methylazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(tert-butylsulfinylamino)-4-methylazepane-1-carboxylate |
|---|---|
| PubChem CID | 154652687 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 4-(tert-butylsulfinylamino)-4-methylazepane-1-carboxylate |
| SMILES | CC1(NS(=O)C(C)(C)C)CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O3S/c1-14(2,3)21-13(19)18-11-8-9-16(7,10-12-18)17-22(20)15(4,5)6/h17H,8-12H2,1-7H3 |
| InChIKey | YOWVJWAJMNHURW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |