C22H26N6O3S3 — CID 154653688
(1,1-dioxo-1,4-thiazinan-4-yl)-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653688) has the molecular formula C22H26N6O3S3 and a molecular weight of 518.69 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653688 |
| Molecular Formula | C22H26N6O3S3 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5CCS(=O)(=O)CC5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C22H26N6O3S3/c1-32-17-12-23-21(24-13-17)25-15-3-4-16(11-15)26-22-27-18-5-2-14(10-19(18)33-22)20(29)28-6-8-34(30,31)9-7-28/h2,5,10,12-13,15-16H,3-4,6-9,11H2,1H3,(H,26,27)(H,23,24,25)/t15-,16-/m0/s1 |
| InChIKey | KJJUEOBTZXTAQD-HOTGVXAUSA-N |
| XLogP | 3.12 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |