C23H24N8OS2 — CID 154653537
4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653537) has the molecular formula C23H24N8OS2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653537 |
| Molecular Formula | C23H24N8OS2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5Cc6cn[nH]c6C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C23H24N8OS2/c1-33-17-9-24-22(25-10-17)27-15-3-4-16(7-15)28-23-29-18-5-2-13(6-20(18)34-23)21(32)31-11-14-8-26-30-19(14)12-31/h2,5-6,8-10,15-16H,3-4,7,11-12H2,1H3,(H,26,30)(H,28,29)(H,24,25,27)/t15-,16-/m0/s1 |
| InChIKey | SZGDYSZBWGQTRG-HOTGVXAUSA-N |
| XLogP | 4.13 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |