C20H24N4O3S — CID 155005877
(8aR)-7-[2-(cyclopentylamino)-1,3-benzothiazole-6-carbonyl]-8a-methyl-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 155005877) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is (8aR)-7-[2-(cyclopentylamino)-1,3-benzothiazole-6-carbonyl]-8a-methyl-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | (8aR)-7-[2-(cyclopentylamino)-1,3-benzothiazole-6-carbonyl]-8a-methyl-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 155005877 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (8aR)-7-[2-(cyclopentylamino)-1,3-benzothiazole-6-carbonyl]-8a-methyl-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | C[C@@]12COC(=O)N1CCN(C(=O)c1ccc3nc(NC4CCCC4)sc3c1)C2 |
| InChI | InChI=1S/C20H24N4O3S/c1-20-11-23(8-9-24(20)19(26)27-12-20)17(25)13-6-7-15-16(10-13)28-18(22-15)21-14-4-2-3-5-14/h6-7,10,14H,2-5,8-9,11-12H2,1H3,(H,21,22)/t20-/m1/s1 |
| InChIKey | QNKUYPFEQXZVHB-HXUWFJFHSA-N |
| XLogP | 3.32 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |