C23H35F3N2 — CID 154654497
ethane;4-methylheptane;5-prop-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]-1H-pyrazole (PubChem CID 154654497) has the molecular formula C23H35F3N2 and a molecular weight of 396.54 g/mol. Its IUPAC name is ethane;4-methylheptane;5-prop-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]-1H-pyrazole.
| Compound Name | ethane;4-methylheptane;5-prop-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]-1H-pyrazole |
|---|---|
| PubChem CID | 154654497 |
| Molecular Formula | C23H35F3N2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | ethane;4-methylheptane;5-prop-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]-1H-pyrazole |
| SMILES | C=C(C)c1[nH]ncc1-c1ccccc1C(F)(F)F.CC.CCCC(C)CCC |
| InChI | InChI=1S/C13H11F3N2.C8H18.C2H6/c1-8(2)12-10(7-17-18-12)9-5-3-4-6-11(9)13(14,15)16;1-4-6-8(3)7-5-2;1-2/h3-7H,1H2,2H3,(H,17,18);8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | XWHACKIVSKSLJU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |