C13H12N4O2 — CID 154655443
N-(5-aminopyrazin-2-yl)-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 154655443) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-(5-aminopyrazin-2-yl)-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | N-(5-aminopyrazin-2-yl)-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 154655443 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(5-aminopyrazin-2-yl)-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | Nc1cnc(NC(=O)c2cccc3c2OCC3)cn1 |
| InChI | InChI=1S/C13H12N4O2/c14-10-6-16-11(7-15-10)17-13(18)9-3-1-2-8-4-5-19-12(8)9/h1-3,6-7H,4-5H2,(H2,14,15)(H,16,17,18) |
| InChIKey | DJCHTXWOVKEUPM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |