C30H27ClN8O — CID 154657915
2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol (PubChem CID 154657915) has the molecular formula C30H27ClN8O and a molecular weight of 551.05 g/mol. Its IUPAC name is 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 154657915 |
| Molecular Formula | C30H27ClN8O |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-[6-[[[(2E)-2-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cccc(C/N=C/C(=N\N)c2nc(-c3cc(Cl)c4ncccc4c3)c(-c3ccccc3)nc2N)n1 |
| InChI | InChI=1S/C30H27ClN8O/c1-30(2,40)24-12-6-11-21(36-24)16-34-17-23(39-33)28-29(32)38-26(18-8-4-3-5-9-18)27(37-28)20-14-19-10-7-13-35-25(19)22(31)15-20/h3-15,17,40H,16,33H2,1-2H3,(H2,32,38)/b34-17+,39-23+ |
| InChIKey | SYTGPTLSQLNQED-USIKHMSVSA-N |
| XLogP | 5.15 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|