C10H9ClF3NO — CID 154659574
N-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]formamide (PubChem CID 154659574) has the molecular formula C10H9ClF3NO and a molecular weight of 251.64 g/mol. Its IUPAC name is N-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]formamide.
| Compound Name | N-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 154659574 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.64 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]formamide |
| SMILES | C[C@H](NC=O)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9ClF3NO/c1-6(15-5-16)8-3-2-7(4-9(8)11)10(12,13)14/h2-6H,1H3,(H,15,16)/t6-/m0/s1 |
| InChIKey | WADKQRZWGMSRAU-LURJTMIESA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|