C9H14N6OS2 — CID 154659697
1-[5-(aminocarbamothioyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea (PubChem CID 154659697) has the molecular formula C9H14N6OS2 and a molecular weight of 286.39 g/mol. Its IUPAC name is 1-[5-(aminocarbamothioyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea.
| Compound Name | 1-[5-(aminocarbamothioyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 154659697 |
| Molecular Formula | C9H14N6OS2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-[5-(aminocarbamothioyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1nc2c(s1)CN(C(=S)NN)CC2 |
| InChI | InChI=1S/C9H14N6OS2/c1-11-7(16)13-8-12-5-2-3-15(9(17)14-10)4-6(5)18-8/h2-4,10H2,1H3,(H,14,17)(H2,11,12,13,16) |
| InChIKey | NMPUQPCRCCUCDF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|