C18H32N6O3S2Si — CID 154659800
1-[5-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea (PubChem CID 154659800) has the molecular formula C18H32N6O3S2Si and a molecular weight of 472.71 g/mol. Its IUPAC name is 1-[5-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea.
| Compound Name | 1-[5-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 154659800 |
| Molecular Formula | C18H32N6O3S2Si |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[5-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1nc2c(s1)CN(C(=S)NNC(=O)[C@@H](C)O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C18H32N6O3S2Si/c1-11(27-30(6,7)18(2,3)4)14(25)22-23-17(28)24-9-8-12-13(10-24)29-16(20-12)21-15(26)19-5/h11H,8-10H2,1-7H3,(H,22,25)(H,23,28)(H2,19,20,21,26)/t11-/m1/s1 |
| InChIKey | ADJINCAHZQYKMV-LLVKDONJSA-N |
| XLogP | 2.57 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|