C13H21N4O2PS — CID 88932094
1-(5-tert-butylphosphanylcarbonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-methylurea (PubChem CID 88932094) has the molecular formula C13H21N4O2PS and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-(5-tert-butylphosphanylcarbonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-methylurea.
| Compound Name | 1-(5-tert-butylphosphanylcarbonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-methylurea |
|---|---|
| PubChem CID | 88932094 |
| Molecular Formula | C13H21N4O2PS |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(5-tert-butylphosphanylcarbonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-methylurea |
| SMILES | CNC(=O)Nc1nc2c(s1)CN(C(=O)PC(C)(C)C)CC2 |
| InChI | InChI=1S/C13H21N4O2PS/c1-13(2,3)20-12(19)17-6-5-8-9(7-17)21-11(15-8)16-10(18)14-4/h20H,5-7H2,1-4H3,(H2,14,15,16,18) |
| InChIKey | VIVICQRKBVWGKO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|