C17H22N4O2 — CID 154660711
N-butyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 154660711) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-butyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-butyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 154660711 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-butyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(-c2noc([C@@H]3CCNC3)n2)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-2-3-9-19-16(22)13-6-4-12(5-7-13)15-20-17(23-21-15)14-8-10-18-11-14/h4-7,14,18H,2-3,8-11H2,1H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | DQOJEJLUANZNSY-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|