C21H30N4O2 — CID 154661041
N-octyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 154661041) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-octyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-octyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 154661041 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-octyl-4-[5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CCCCCCCCNC(=O)c1ccc(-c2noc([C@@H]3CCNC3)n2)cc1 |
| InChI | InChI=1S/C21H30N4O2/c1-2-3-4-5-6-7-13-23-20(26)17-10-8-16(9-11-17)19-24-21(27-25-19)18-12-14-22-15-18/h8-11,18,22H,2-7,12-15H2,1H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | GDOXJENTSAWOKF-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|