C18H16F4N2OS — CID 154665171
2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-4-fluoro-3-(sulfanylamino)pyrrolidine-1-carbaldehyde (PubChem CID 154665171) has the molecular formula C18H16F4N2OS and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-4-fluoro-3-(sulfanylamino)pyrrolidine-1-carbaldehyde.
| Compound Name | 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-4-fluoro-3-(sulfanylamino)pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 154665171 |
| Molecular Formula | C18H16F4N2OS |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-4-fluoro-3-(sulfanylamino)pyrrolidine-1-carbaldehyde |
| SMILES | O=CN1CC(F)C(NS)C1Cc1cccc(-c2cc(F)ccc2F)c1F |
| InChI | InChI=1S/C18H16F4N2OS/c19-11-4-5-14(20)13(7-11)12-3-1-2-10(17(12)22)6-16-18(23-26)15(21)8-24(16)9-25/h1-5,7,9,15-16,18,23,26H,6,8H2 |
| InChIKey | SVAXSSSWZGKGEB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|