C20H21F3N2OS — CID 154665439
2-[[3-(2,5-difluorophenyl)phenyl]methyl]-3-(ethylsulfanylamino)-4-fluoropyrrolidine-1-carbaldehyde (PubChem CID 154665439) has the molecular formula C20H21F3N2OS and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[[3-(2,5-difluorophenyl)phenyl]methyl]-3-(ethylsulfanylamino)-4-fluoropyrrolidine-1-carbaldehyde.
| Compound Name | 2-[[3-(2,5-difluorophenyl)phenyl]methyl]-3-(ethylsulfanylamino)-4-fluoropyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 154665439 |
| Molecular Formula | C20H21F3N2OS |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[[3-(2,5-difluorophenyl)phenyl]methyl]-3-(ethylsulfanylamino)-4-fluoropyrrolidine-1-carbaldehyde |
| SMILES | CCSNC1C(F)CN(C=O)C1Cc1cccc(-c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C20H21F3N2OS/c1-2-27-24-20-18(23)11-25(12-26)19(20)9-13-4-3-5-14(8-13)16-10-15(21)6-7-17(16)22/h3-8,10,12,18-20,24H,2,9,11H2,1H3 |
| InChIKey | DFAVXYURPDOTBN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|