C27H37F3N2S — CID 142524803
2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-1-methylpyrrolidin-3-amine;ethanethiol;2-methylpropylidenecyclopropane (PubChem CID 142524803) has the molecular formula C27H37F3N2S and a molecular weight of 478.67 g/mol. Its IUPAC name is 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-1-methylpyrrolidin-3-amine;ethanethiol;2-methylpropylidenecyclopropane.
| Compound Name | 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-1-methylpyrrolidin-3-amine;ethanethiol;2-methylpropylidenecyclopropane |
|---|---|
| PubChem CID | 142524803 |
| Molecular Formula | C27H37F3N2S |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methyl]-1-methylpyrrolidin-3-amine;ethanethiol;2-methylpropylidenecyclopropane |
| SMILES | CC(C)C=C1CC1.CCS.CN1CCC(N)C1Cc1cccc(-c2cc(F)ccc2F)c1F |
| InChI | InChI=1S/C18H19F3N2.C7H12.C2H6S/c1-23-8-7-16(22)17(23)9-11-3-2-4-13(18(11)21)14-10-12(19)5-6-15(14)20;1-6(2)5-7-3-4-7;1-2-3/h2-6,10,16-17H,7-9,22H2,1H3;5-6H,3-4H2,1-2H3;3H,2H2,1H3 |
| InChIKey | JBSXPLIYPDFVBG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|