C23H29F2N2O3S+ — CID 154665197
CID 154665197 (PubChem CID 154665197) has the molecular formula C23H29F2N2O3S+ and a molecular weight of 451.56 g/mol.
| Compound Name | CID 154665197 |
|---|---|
| PubChem CID | 154665197 |
| Molecular Formula | C23H29F2N2O3S+ |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)N[C@@H]1[C@H](Cc2cccc(-c3ccccc3)c2)N(C(=O)C(C)C)CC1(F)F |
| InChI | InChI=1S/C23H28F2N2O3S/c1-4-31(29,30)26-21-20(27(15-23(21,24)25)22(28)16(2)3)14-17-9-8-12-19(13-17)18-10-6-5-7-11-18/h5-13,16,20-21H,4,14-15H2,1-3H3,(H-,26,29,30)/p+1/t20-,21+/m0/s1 |
| InChIKey | UGHVHLCRQQFQTB-LEWJYISDSA-O |
| XLogP | 4.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|