C23H26F3N2O4S+ — CID 154665390
CID 154665390 (PubChem CID 154665390) has the molecular formula C23H26F3N2O4S+ and a molecular weight of 483.53 g/mol.
| Compound Name | CID 154665390 |
|---|---|
| PubChem CID | 154665390 |
| Molecular Formula | C23H26F3N2O4S+ |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)N[C@@H]1[C@H](Cc2cccc(-c3cccc(F)c3)c2)N(C(=O)C2CCO2)CC1(F)F |
| InChI | InChI=1S/C23H25F3N2O4S/c1-2-33(30,31)27-21-19(28(14-23(21,25)26)22(29)20-9-10-32-20)12-15-5-3-6-16(11-15)17-7-4-8-18(24)13-17/h3-8,11,13,19-21H,2,9-10,12,14H2,1H3,(H-,27,30,31)/p+1/t19-,20?,21+/m0/s1 |
| InChIKey | KZZOKXZXDSQIPG-SIGULFFNSA-O |
| XLogP | 3.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|