C21H23F3N2O2S — CID 169174003
1-[4,4-difluoro-3-(fluoromethylsulfanylamino)-2-[[3-(2-hydroxyphenyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 169174003) has the molecular formula C21H23F3N2O2S and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[4,4-difluoro-3-(fluoromethylsulfanylamino)-2-[[3-(2-hydroxyphenyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-[4,4-difluoro-3-(fluoromethylsulfanylamino)-2-[[3-(2-hydroxyphenyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 169174003 |
| Molecular Formula | C21H23F3N2O2S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[4,4-difluoro-3-(fluoromethylsulfanylamino)-2-[[3-(2-hydroxyphenyl)phenyl]methyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC(F)(F)C(NSCF)C1Cc1cccc(-c2ccccc2O)c1 |
| InChI | InChI=1S/C21H23F3N2O2S/c1-2-19(28)26-12-21(23,24)20(25-29-13-22)17(26)11-14-6-5-7-15(10-14)16-8-3-4-9-18(16)27/h3-10,17,20,25,27H,2,11-13H2,1H3 |
| InChIKey | SDYTZBODRYOEJX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|