C24H34Si2 — CID 15466551
trimethyl-[11-methyl-3-propan-2-ylidene-10-(2-trimethylsilylethynyl)dodec-10-en-1,4,8-triynyl]silane (PubChem CID 15466551) has the molecular formula C24H34Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is trimethyl-[11-methyl-3-propan-2-ylidene-10-(2-trimethylsilylethynyl)dodec-10-en-1,4,8-triynyl]silane.
| Compound Name | trimethyl-[11-methyl-3-propan-2-ylidene-10-(2-trimethylsilylethynyl)dodec-10-en-1,4,8-triynyl]silane |
|---|---|
| PubChem CID | 15466551 |
| Molecular Formula | C24H34Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | trimethyl-[11-methyl-3-propan-2-ylidene-10-(2-trimethylsilylethynyl)dodec-10-en-1,4,8-triynyl]silane |
| SMILES | CC(C)=C(C#CCCC#CC(C#C[Si](C)(C)C)=C(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C24H34Si2/c1-21(2)23(17-19-25(5,6)7)15-13-11-12-14-16-24(22(3)4)18-20-26(8,9)10/h11-12H2,1-10H3 |
| InChIKey | PMWVVLXFDPLJQN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|