C25H34N4O3S2 — CID 154668003
cyclohexanol;N-ethyl-1-[methyl(methylidene)-λ4-sulfanyl]pyrrole-3-carboxamide;N-(4-phenyl-1,3-thiazol-2-yl)formamide (PubChem CID 154668003) has the molecular formula C25H34N4O3S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is cyclohexanol;N-ethyl-1-[methyl(methylidene)-λ4-sulfanyl]pyrrole-3-carboxamide;N-(4-phenyl-1,3-thiazol-2-yl)formamide.
| Compound Name | cyclohexanol;N-ethyl-1-[methyl(methylidene)-λ4-sulfanyl]pyrrole-3-carboxamide;N-(4-phenyl-1,3-thiazol-2-yl)formamide |
|---|---|
| PubChem CID | 154668003 |
| Molecular Formula | C25H34N4O3S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | cyclohexanol;N-ethyl-1-[methyl(methylidene)-λ4-sulfanyl]pyrrole-3-carboxamide;N-(4-phenyl-1,3-thiazol-2-yl)formamide |
| SMILES | C=S(C)n1ccc(C(=O)NCC)c1.O=CNc1nc(-c2ccccc2)cs1.OC1CCCCC1 |
| InChI | InChI=1S/C10H8N2OS.C9H14N2OS.C6H12O/c13-7-11-10-12-9(6-14-10)8-4-2-1-3-5-8;1-4-10-9(12)8-5-6-11(7-8)13(2)3;7-6-4-2-1-3-5-6/h1-7H,(H,11,12,13);5-7H,2,4H2,1,3H3,(H,10,12);6-7H,1-5H2 |
| InChIKey | FEVJVVZKGYTUFA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|