C17H16BN4O2S — CID 154668415
CID 154668415 (PubChem CID 154668415) has the molecular formula C17H16BN4O2S and a molecular weight of 351.22 g/mol.
| Compound Name | CID 154668415 |
|---|---|
| PubChem CID | 154668415 |
| Molecular Formula | C17H16BN4O2S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | — |
| SMILES | C[B]n1ccc(C(=O)NCC(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C17H16BN4O2S/c1-18-22-8-7-13(10-22)16(24)19-9-15(23)21-17-20-14(11-25-17)12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3,(H,19,24)(H,20,21,23) |
| InChIKey | JNOGZIWZWFAPEN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|